C35H36O7S — CID 155242023
3-[[9-methyl-7-[4-(4-prop-2-enoyloxybutoxy)benzoyl]sulfanyl-9H-fluoren-2-yl]oxy]propyl 2-methylprop-2-enoate (PubChem CID 155242023) has the molecular formula C35H36O7S and a molecular weight of 600.73 g/mol. Its IUPAC name is 3-[[9-methyl-7-[4-(4-prop-2-enoyloxybutoxy)benzoyl]sulfanyl-9H-fluoren-2-yl]oxy]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[[9-methyl-7-[4-(4-prop-2-enoyloxybutoxy)benzoyl]sulfanyl-9H-fluoren-2-yl]oxy]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155242023 |
| Molecular Formula | C35H36O7S |
| Molecular Weight | 600.73 g/mol |
| Exact Mass | 600.22 |
| IUPAC Name | 3-[[9-methyl-7-[4-(4-prop-2-enoyloxybutoxy)benzoyl]sulfanyl-9H-fluoren-2-yl]oxy]propyl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Sc2ccc3c(c2)C(C)c2cc(OCCCOC(=O)C(=C)C)ccc2-3)cc1 |
| InChI | InChI=1S/C35H36O7S/c1-5-33(36)41-18-7-6-17-39-26-11-9-25(10-12-26)35(38)43-28-14-16-30-29-15-13-27(21-31(29)24(4)32(30)22-28)40-19-8-20-42-34(37)23(2)3/h5,9-16,21-22,24H,1-2,6-8,17-20H2,3-4H3 |
| InChIKey | GZMKFBNYTBENKB-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.73 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|