C38H42O7S — CID 155241551
6-[4-[8-ethyl-9-methyl-7-(2-prop-2-enoyloxyethoxy)-9H-fluorene-2-carbonyl]sulfanylphenoxy]hexyl 2-methylprop-2-enoate (PubChem CID 155241551) has the molecular formula C38H42O7S and a molecular weight of 642.81 g/mol. Its IUPAC name is 6-[4-[8-ethyl-9-methyl-7-(2-prop-2-enoyloxyethoxy)-9H-fluorene-2-carbonyl]sulfanylphenoxy]hexyl 2-methylprop-2-enoate.
| Compound Name | 6-[4-[8-ethyl-9-methyl-7-(2-prop-2-enoyloxyethoxy)-9H-fluorene-2-carbonyl]sulfanylphenoxy]hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155241551 |
| Molecular Formula | C38H42O7S |
| Molecular Weight | 642.81 g/mol |
| Exact Mass | 642.27 |
| IUPAC Name | 6-[4-[8-ethyl-9-methyl-7-(2-prop-2-enoyloxyethoxy)-9H-fluorene-2-carbonyl]sulfanylphenoxy]hexyl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OCCOc1ccc2c(c1CC)C(C)c1cc(C(=O)Sc3ccc(OCCCCCCOC(=O)C(=C)C)cc3)ccc1-2 |
| InChI | InChI=1S/C38H42O7S/c1-6-30-34(43-22-23-44-35(39)7-2)19-18-32-31-17-12-27(24-33(31)26(5)36(30)32)38(41)46-29-15-13-28(14-16-29)42-20-10-8-9-11-21-45-37(40)25(3)4/h7,12-19,24,26H,2-3,6,8-11,20-23H2,1,4-5H3 |
| InChIKey | YZLCIRCYWVQZBC-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.81 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|