C40H32O6S2 — CID 155241973
2-[4-[4-[2-[4-[2-[4-(3-prop-2-enoylsulfanylpropoxy)phenyl]ethynyl]phenyl]ethynyl]benzoyl]sulfanylphenoxy]ethyl prop-2-enoate (PubChem CID 155241973) has the molecular formula C40H32O6S2 and a molecular weight of 672.82 g/mol. Its IUPAC name is 2-[4-[4-[2-[4-[2-[4-(3-prop-2-enoylsulfanylpropoxy)phenyl]ethynyl]phenyl]ethynyl]benzoyl]sulfanylphenoxy]ethyl prop-2-enoate.
| Compound Name | 2-[4-[4-[2-[4-[2-[4-(3-prop-2-enoylsulfanylpropoxy)phenyl]ethynyl]phenyl]ethynyl]benzoyl]sulfanylphenoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 155241973 |
| Molecular Formula | C40H32O6S2 |
| Molecular Weight | 672.82 g/mol |
| Exact Mass | 672.16 |
| IUPAC Name | 2-[4-[4-[2-[4-[2-[4-(3-prop-2-enoylsulfanylpropoxy)phenyl]ethynyl]phenyl]ethynyl]benzoyl]sulfanylphenoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1ccc(SC(=O)c2ccc(C#Cc3ccc(C#Cc4ccc(OCCCSC(=O)C=C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C40H32O6S2/c1-3-38(41)46-28-27-45-36-22-24-37(25-23-36)48-40(43)34-18-14-32(15-19-34)12-10-30-6-8-31(9-7-30)11-13-33-16-20-35(21-17-33)44-26-5-29-47-39(42)4-2/h3-4,6-9,14-25H,1-2,5,26-29H2 |
| InChIKey | WIDUFMUEIDVZAD-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.82 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|