C44H42O7S — CID 155241864
4-[4-[4-[2-[4-[2-[4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]ethynyl]phenyl]ethynyl]benzoyl]sulfanylcyclohexa-1,5-dien-1-yl]oxybutyl 2-methylprop-2-enoate (PubChem CID 155241864) has the molecular formula C44H42O7S and a molecular weight of 714.88 g/mol. Its IUPAC name is 4-[4-[4-[2-[4-[2-[4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]ethynyl]phenyl]ethynyl]benzoyl]sulfanylcyclohexa-1,5-dien-1-yl]oxybutyl 2-methylprop-2-enoate.
| Compound Name | 4-[4-[4-[2-[4-[2-[4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]ethynyl]phenyl]ethynyl]benzoyl]sulfanylcyclohexa-1,5-dien-1-yl]oxybutyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155241864 |
| Molecular Formula | C44H42O7S |
| Molecular Weight | 714.88 g/mol |
| Exact Mass | 714.27 |
| IUPAC Name | 4-[4-[4-[2-[4-[2-[4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]ethynyl]phenyl]ethynyl]benzoyl]sulfanylcyclohexa-1,5-dien-1-yl]oxybutyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCOC1=CCC(SC(=O)c2ccc(C#Cc3ccc(C#Cc4ccc(OCCCOC(=O)C(=C)C)cc4)cc3)cc2)C=C1 |
| InChI | InChI=1S/C44H42O7S/c1-32(2)42(45)50-29-6-5-28-48-40-24-26-41(27-25-40)52-44(47)38-20-16-36(17-21-38)14-12-34-8-10-35(11-9-34)13-15-37-18-22-39(23-19-37)49-30-7-31-51-43(46)33(3)4/h8-11,16-26,41H,1,3,5-7,27-31H2,2,4H3 |
| InChIKey | PXOGNBDVTQVIBR-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.88 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|