C35H24F2O7 — CID 139409120
[4-[4-[2-[4-(3-ethenoxy-3-oxopropoxy)-3-fluorophenyl]ethynyl]phenyl]phenyl] 4-(2-fluoroprop-2-enoyloxy)benzoate (PubChem CID 139409120) has the molecular formula C35H24F2O7 and a molecular weight of 594.57 g/mol. Its IUPAC name is [4-[4-[2-[4-(3-ethenoxy-3-oxopropoxy)-3-fluorophenyl]ethynyl]phenyl]phenyl] 4-(2-fluoroprop-2-enoyloxy)benzoate.
| Compound Name | [4-[4-[2-[4-(3-ethenoxy-3-oxopropoxy)-3-fluorophenyl]ethynyl]phenyl]phenyl] 4-(2-fluoroprop-2-enoyloxy)benzoate |
|---|---|
| PubChem CID | 139409120 |
| Molecular Formula | C35H24F2O7 |
| Molecular Weight | 594.57 g/mol |
| Exact Mass | 594.15 |
| IUPAC Name | [4-[4-[2-[4-(3-ethenoxy-3-oxopropoxy)-3-fluorophenyl]ethynyl]phenyl]phenyl] 4-(2-fluoroprop-2-enoyloxy)benzoate |
| SMILES | C=COC(=O)CCOc1ccc(C#Cc2ccc(-c3ccc(OC(=O)c4ccc(OC(=O)C(=C)F)cc4)cc3)cc2)cc1F |
| InChI | InChI=1S/C35H24F2O7/c1-3-41-33(38)20-21-42-32-19-8-25(22-31(32)37)5-4-24-6-9-26(10-7-24)27-11-15-30(16-12-27)44-35(40)28-13-17-29(18-14-28)43-34(39)23(2)36/h3,6-19,22H,1-2,20-21H2 |
| InChIKey | JUJNBQRRFHXFJD-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.57 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|