About (4-prop-2-enoxyphenyl) 4-prop-2-enoxybenzoate
(4-prop-2-enoxyphenyl) 4-prop-2-enoxybenzoate (PubChem CID 70257888) has the molecular formula C19H18O4
and a molecular weight of 310.35 g/mol. Its IUPAC name is (4-prop-2-enoxyphenyl) 4-prop-2-enoxybenzoate.
Molecular Properties
| Compound Name | (4-prop-2-enoxyphenyl) 4-prop-2-enoxybenzoate |
| PubChem CID | 70257888 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (4-prop-2-enoxyphenyl) 4-prop-2-enoxybenzoate |
| SMILES | C=CCOc1ccc(OC(=O)c2ccc(OCC=C)cc2)cc1 |
| InChI | InChI=1S/C19H18O4/c1-3-13-21-16-7-5-15(6-8-16)19(20)23-18-11-9-17(10-12-18)22-14-4-2/h3-12H,1-2,13-14H2 |
| InChIKey | KYEPKIQZNLBTDR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-prop-2-enoxyphenyl) 4-prop-2-enoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-prop-2-enoxyphenyl) 4-prop-2-enoxybenzoate?
The IUPAC name of (4-prop-2-enoxyphenyl) 4-prop-2-enoxybenzoate (CID 70257888) is (4-prop-2-enoxyphenyl) 4-prop-2-enoxybenzoate.
What is the SMILES notation for (4-prop-2-enoxyphenyl) 4-prop-2-enoxybenzoate?
The canonical SMILES for (4-prop-2-enoxyphenyl) 4-prop-2-enoxybenzoate is C=CCOc1ccc(OC(=O)c2ccc(OCC=C)cc2)cc1.
What is the InChIKey of (4-prop-2-enoxyphenyl) 4-prop-2-enoxybenzoate?
The InChIKey is KYEPKIQZNLBTDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18O4/c1-3-13-21-16-7-5-15(6-8-16)19(20)23-18-11-9-17(10-12-18)22-14-4-2/h3-12H,1-2,13-14H2.
What are the key properties of (4-prop-2-enoxyphenyl) 4-prop-2-enoxybenzoate?
(4-prop-2-enoxyphenyl) 4-prop-2-enoxybenzoate has a molecular weight of 310.35 g/mol, XLogP of 4.04, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-prop-2-enoxyphenyl) 4-prop-2-enoxybenzoate is sourced from PubChem (CID 70257888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).