C20H14F2O3 — CID 139854089
(4-prop-2-enoxyphenyl) 6,7-difluoronaphthalene-2-carboxylate (PubChem CID 139854089) has the molecular formula C20H14F2O3 and a molecular weight of 340.33 g/mol. Its IUPAC name is (4-prop-2-enoxyphenyl) 6,7-difluoronaphthalene-2-carboxylate.
| Compound Name | (4-prop-2-enoxyphenyl) 6,7-difluoronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 139854089 |
| Molecular Formula | C20H14F2O3 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | (4-prop-2-enoxyphenyl) 6,7-difluoronaphthalene-2-carboxylate |
| SMILES | C=CCOc1ccc(OC(=O)c2ccc3cc(F)c(F)cc3c2)cc1 |
| InChI | InChI=1S/C20H14F2O3/c1-2-9-24-16-5-7-17(8-6-16)25-20(23)14-4-3-13-11-18(21)19(22)12-15(13)10-14/h2-8,10-12H,1,9H2 |
| InChIKey | KZBWIYUAEBFEDG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|