C21H14F4O4 — CID 139855341
[6-(difluoromethoxy)-5,7-difluoronaphthalen-2-yl] 4-prop-2-enoxybenzoate (PubChem CID 139855341) has the molecular formula C21H14F4O4 and a molecular weight of 406.33 g/mol. Its IUPAC name is [6-(difluoromethoxy)-5,7-difluoronaphthalen-2-yl] 4-prop-2-enoxybenzoate.
| Compound Name | [6-(difluoromethoxy)-5,7-difluoronaphthalen-2-yl] 4-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 139855341 |
| Molecular Formula | C21H14F4O4 |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | [6-(difluoromethoxy)-5,7-difluoronaphthalen-2-yl] 4-prop-2-enoxybenzoate |
| SMILES | C=CCOc1ccc(C(=O)Oc2ccc3c(F)c(OC(F)F)c(F)cc3c2)cc1 |
| InChI | InChI=1S/C21H14F4O4/c1-2-9-27-14-5-3-12(4-6-14)20(26)28-15-7-8-16-13(10-15)11-17(22)19(18(16)23)29-21(24)25/h2-8,10-11,21H,1,9H2 |
| InChIKey | SHYAOVUFLLWWMZ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|