C23H17F5O3 — CID 139856179
[5,7-difluoro-6-(2,2,2-trifluoroethoxy)naphthalen-2-yl] 4-but-3-enylbenzoate (PubChem CID 139856179) has the molecular formula C23H17F5O3 and a molecular weight of 436.38 g/mol. Its IUPAC name is [5,7-difluoro-6-(2,2,2-trifluoroethoxy)naphthalen-2-yl] 4-but-3-enylbenzoate.
| Compound Name | [5,7-difluoro-6-(2,2,2-trifluoroethoxy)naphthalen-2-yl] 4-but-3-enylbenzoate |
|---|---|
| PubChem CID | 139856179 |
| Molecular Formula | C23H17F5O3 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | [5,7-difluoro-6-(2,2,2-trifluoroethoxy)naphthalen-2-yl] 4-but-3-enylbenzoate |
| SMILES | C=CCCc1ccc(C(=O)Oc2ccc3c(F)c(OCC(F)(F)F)c(F)cc3c2)cc1 |
| InChI | InChI=1S/C23H17F5O3/c1-2-3-4-14-5-7-15(8-6-14)22(29)31-17-9-10-18-16(11-17)12-19(24)21(20(18)25)30-13-23(26,27)28/h2,5-12H,1,3-4,13H2 |
| InChIKey | KPZODLLMSPKUJM-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|