C22H18F4O3 — CID 139856461
[5-fluoro-6-(2,2,2-trifluoroethoxy)naphthalen-2-yl] 4-propylbenzoate (PubChem CID 139856461) has the molecular formula C22H18F4O3 and a molecular weight of 406.38 g/mol. Its IUPAC name is [5-fluoro-6-(2,2,2-trifluoroethoxy)naphthalen-2-yl] 4-propylbenzoate.
| Compound Name | [5-fluoro-6-(2,2,2-trifluoroethoxy)naphthalen-2-yl] 4-propylbenzoate |
|---|---|
| PubChem CID | 139856461 |
| Molecular Formula | C22H18F4O3 |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | [5-fluoro-6-(2,2,2-trifluoroethoxy)naphthalen-2-yl] 4-propylbenzoate |
| SMILES | CCCc1ccc(C(=O)Oc2ccc3c(F)c(OCC(F)(F)F)ccc3c2)cc1 |
| InChI | InChI=1S/C22H18F4O3/c1-2-3-14-4-6-15(7-5-14)21(27)29-17-9-10-18-16(12-17)8-11-19(20(18)23)28-13-22(24,25)26/h4-12H,2-3,13H2,1H3 |
| InChIKey | GWCJISYAJSDGHO-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|