C20H15F3O2 — CID 139854655
(2-fluoro-4-propylphenyl) 5,6-difluoronaphthalene-2-carboxylate (PubChem CID 139854655) has the molecular formula C20H15F3O2 and a molecular weight of 344.33 g/mol. Its IUPAC name is (2-fluoro-4-propylphenyl) 5,6-difluoronaphthalene-2-carboxylate.
| Compound Name | (2-fluoro-4-propylphenyl) 5,6-difluoronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 139854655 |
| Molecular Formula | C20H15F3O2 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | (2-fluoro-4-propylphenyl) 5,6-difluoronaphthalene-2-carboxylate |
| SMILES | CCCc1ccc(OC(=O)c2ccc3c(F)c(F)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C20H15F3O2/c1-2-3-12-4-9-18(17(22)10-12)25-20(24)14-5-7-15-13(11-14)6-8-16(21)19(15)23/h4-11H,2-3H2,1H3 |
| InChIKey | JRVWCXJESAIJBW-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|