C19H13F3O3 — CID 139854348
(4-ethoxy-2-fluorophenyl) 5,6-difluoronaphthalene-2-carboxylate (PubChem CID 139854348) has the molecular formula C19H13F3O3 and a molecular weight of 346.30 g/mol. Its IUPAC name is (4-ethoxy-2-fluorophenyl) 5,6-difluoronaphthalene-2-carboxylate.
| Compound Name | (4-ethoxy-2-fluorophenyl) 5,6-difluoronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 139854348 |
| Molecular Formula | C19H13F3O3 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | (4-ethoxy-2-fluorophenyl) 5,6-difluoronaphthalene-2-carboxylate |
| SMILES | CCOc1ccc(OC(=O)c2ccc3c(F)c(F)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C19H13F3O3/c1-2-24-13-5-8-17(16(21)10-13)25-19(23)12-3-6-14-11(9-12)4-7-15(20)18(14)22/h3-10H,2H2,1H3 |
| InChIKey | SHJQEYPKDVFVAM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|