C22H19F3O2 — CID 139853883
(2-fluoro-4-pentylphenyl) 6,7-difluoronaphthalene-2-carboxylate (PubChem CID 139853883) has the molecular formula C22H19F3O2 and a molecular weight of 372.39 g/mol. Its IUPAC name is (2-fluoro-4-pentylphenyl) 6,7-difluoronaphthalene-2-carboxylate.
| Compound Name | (2-fluoro-4-pentylphenyl) 6,7-difluoronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 139853883 |
| Molecular Formula | C22H19F3O2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | (2-fluoro-4-pentylphenyl) 6,7-difluoronaphthalene-2-carboxylate |
| SMILES | CCCCCc1ccc(OC(=O)c2ccc3cc(F)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C22H19F3O2/c1-2-3-4-5-14-6-9-21(20(25)10-14)27-22(26)16-8-7-15-12-18(23)19(24)13-17(15)11-16/h6-13H,2-5H2,1H3 |
| InChIKey | VVGQCJRJRGNRRE-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|