C30H33FO4 — CID 139666010
4-[4-(4-decylphenyl)benzoyl]oxy-3-fluorobenzoic acid (PubChem CID 139666010) has the molecular formula C30H33FO4 and a molecular weight of 476.59 g/mol. Its IUPAC name is 4-[4-(4-decylphenyl)benzoyl]oxy-3-fluorobenzoic acid.
| Compound Name | 4-[4-(4-decylphenyl)benzoyl]oxy-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 139666010 |
| Molecular Formula | C30H33FO4 |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 4-[4-(4-decylphenyl)benzoyl]oxy-3-fluorobenzoic acid |
| SMILES | CCCCCCCCCCc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)O)cc3F)cc2)cc1 |
| InChI | InChI=1S/C30H33FO4/c1-2-3-4-5-6-7-8-9-10-22-11-13-23(14-12-22)24-15-17-25(18-16-24)30(34)35-28-20-19-26(29(32)33)21-27(28)31/h11-21H,2-10H2,1H3,(H,32,33) |
| InChIKey | KACUNEYMEWSLMI-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|