C61H70F4O6 — CID 88595180
(4-ethyl-2-fluorophenyl) 4-(3-fluoro-4-nonoxyphenyl)benzoate;(2-fluoro-4-propylphenyl) 4-(3-fluoro-4-nonoxyphenyl)benzoate (PubChem CID 88595180) has the molecular formula C61H70F4O6 and a molecular weight of 975.22 g/mol. Its IUPAC name is (4-ethyl-2-fluorophenyl) 4-(3-fluoro-4-nonoxyphenyl)benzoate;(2-fluoro-4-propylphenyl) 4-(3-fluoro-4-nonoxyphenyl)benzoate.
| Compound Name | (4-ethyl-2-fluorophenyl) 4-(3-fluoro-4-nonoxyphenyl)benzoate;(2-fluoro-4-propylphenyl) 4-(3-fluoro-4-nonoxyphenyl)benzoate |
|---|---|
| PubChem CID | 88595180 |
| Molecular Formula | C61H70F4O6 |
| Molecular Weight | 975.22 g/mol |
| Exact Mass | 974.51 |
| IUPAC Name | (4-ethyl-2-fluorophenyl) 4-(3-fluoro-4-nonoxyphenyl)benzoate;(2-fluoro-4-propylphenyl) 4-(3-fluoro-4-nonoxyphenyl)benzoate |
| SMILES | CCCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(CC)cc3F)cc2)cc1F.CCCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(CCC)cc3F)cc2)cc1F |
| InChI | InChI=1S/C31H36F2O3.C30H34F2O3/c1-3-5-6-7-8-9-10-20-35-29-19-17-26(22-28(29)33)24-13-15-25(16-14-24)31(34)36-30-18-12-23(11-4-2)21-27(30)32;1-3-5-6-7-8-9-10-19-34-28-18-16-25(21-27(28)32)23-12-14-24(15-13-23)30(33)35-29-17-11-22(4-2)20-26(29)31/h12-19,21-22H,3-11,20H2,1-2H3;11-18,20-21H,3-10,19H2,1-2H3 |
| InChIKey | UNVLSEWIPXTYRT-UHFFFAOYSA-N |
| XLogP | 17.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 975.22 |
| LogP ≤ 5 | 17.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|