C20H13F3O3 — CID 139854403
(5,6-difluoronaphthalen-2-yl) 2-fluoro-4-prop-2-enoxybenzoate (PubChem CID 139854403) has the molecular formula C20H13F3O3 and a molecular weight of 358.32 g/mol. Its IUPAC name is (5,6-difluoronaphthalen-2-yl) 2-fluoro-4-prop-2-enoxybenzoate.
| Compound Name | (5,6-difluoronaphthalen-2-yl) 2-fluoro-4-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 139854403 |
| Molecular Formula | C20H13F3O3 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | (5,6-difluoronaphthalen-2-yl) 2-fluoro-4-prop-2-enoxybenzoate |
| SMILES | C=CCOc1ccc(C(=O)Oc2ccc3c(F)c(F)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C20H13F3O3/c1-2-9-25-13-4-7-16(18(22)11-13)20(24)26-14-5-6-15-12(10-14)3-8-17(21)19(15)23/h2-8,10-11H,1,9H2 |
| InChIKey | BVXSDWNJWUVEFT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|