C18H13F3O3 — CID 146247306
[2,3-difluoro-4-(2-fluoro-4-prop-2-enoxyphenyl)phenyl] prop-2-enoate (PubChem CID 146247306) has the molecular formula C18H13F3O3 and a molecular weight of 334.29 g/mol. Its IUPAC name is [2,3-difluoro-4-(2-fluoro-4-prop-2-enoxyphenyl)phenyl] prop-2-enoate.
| Compound Name | [2,3-difluoro-4-(2-fluoro-4-prop-2-enoxyphenyl)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 146247306 |
| Molecular Formula | C18H13F3O3 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | [2,3-difluoro-4-(2-fluoro-4-prop-2-enoxyphenyl)phenyl] prop-2-enoate |
| SMILES | C=CCOc1ccc(-c2ccc(OC(=O)C=C)c(F)c2F)c(F)c1 |
| InChI | InChI=1S/C18H13F3O3/c1-3-9-23-11-5-6-12(14(19)10-11)13-7-8-15(18(21)17(13)20)24-16(22)4-2/h3-8,10H,1-2,9H2 |
| InChIKey | JUOMXHQJVCUGQB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|