C18H13F3O4 — CID 126518140
[4-[2,3-difluoro-4-(1-hydroxyprop-2-enoxy)phenyl]-3-fluorophenyl] prop-2-enoate (PubChem CID 126518140) has the molecular formula C18H13F3O4 and a molecular weight of 350.29 g/mol. Its IUPAC name is [4-[2,3-difluoro-4-(1-hydroxyprop-2-enoxy)phenyl]-3-fluorophenyl] prop-2-enoate.
| Compound Name | [4-[2,3-difluoro-4-(1-hydroxyprop-2-enoxy)phenyl]-3-fluorophenyl] prop-2-enoate |
|---|---|
| PubChem CID | 126518140 |
| Molecular Formula | C18H13F3O4 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | [4-[2,3-difluoro-4-(1-hydroxyprop-2-enoxy)phenyl]-3-fluorophenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(-c2ccc(OC(O)C=C)c(F)c2F)c(F)c1 |
| InChI | InChI=1S/C18H13F3O4/c1-3-15(22)24-10-5-6-11(13(19)9-10)12-7-8-14(18(21)17(12)20)25-16(23)4-2/h3-9,16,23H,1-2H2 |
| InChIKey | CCONYROPKDKIIO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|