C20H14F2O5 — CID 123643106
2-[4-(2,3-difluoro-4-prop-2-enoyloxyphenyl)phenoxy]ethenyl prop-2-enoate (PubChem CID 123643106) has the molecular formula C20H14F2O5 and a molecular weight of 372.32 g/mol. Its IUPAC name is 2-[4-(2,3-difluoro-4-prop-2-enoyloxyphenyl)phenoxy]ethenyl prop-2-enoate.
| Compound Name | 2-[4-(2,3-difluoro-4-prop-2-enoyloxyphenyl)phenoxy]ethenyl prop-2-enoate |
|---|---|
| PubChem CID | 123643106 |
| Molecular Formula | C20H14F2O5 |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 2-[4-(2,3-difluoro-4-prop-2-enoyloxyphenyl)phenoxy]ethenyl prop-2-enoate |
| SMILES | C=CC(=O)OC=COc1ccc(-c2ccc(OC(=O)C=C)c(F)c2F)cc1 |
| InChI | InChI=1S/C20H14F2O5/c1-3-17(23)26-12-11-25-14-7-5-13(6-8-14)15-9-10-16(20(22)19(15)21)27-18(24)4-2/h3-12H,1-2H2 |
| InChIKey | OCXHLNQNDUFBIK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|