C22H17FO6 — CID 123899301
2-[4-[2-fluoro-4-(2-prop-2-enoyloxyethenoxy)phenyl]phenoxy]ethenyl prop-2-enoate (PubChem CID 123899301) has the molecular formula C22H17FO6 and a molecular weight of 396.37 g/mol. Its IUPAC name is 2-[4-[2-fluoro-4-(2-prop-2-enoyloxyethenoxy)phenyl]phenoxy]ethenyl prop-2-enoate.
| Compound Name | 2-[4-[2-fluoro-4-(2-prop-2-enoyloxyethenoxy)phenyl]phenoxy]ethenyl prop-2-enoate |
|---|---|
| PubChem CID | 123899301 |
| Molecular Formula | C22H17FO6 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 2-[4-[2-fluoro-4-(2-prop-2-enoyloxyethenoxy)phenyl]phenoxy]ethenyl prop-2-enoate |
| SMILES | C=CC(=O)OC=COc1ccc(-c2ccc(OC=COC(=O)C=C)cc2F)cc1 |
| InChI | InChI=1S/C22H17FO6/c1-3-21(24)28-13-11-26-17-7-5-16(6-8-17)19-10-9-18(15-20(19)23)27-12-14-29-22(25)4-2/h3-15H,1-2H2 |
| InChIKey | MFYQTMSLYWUBNW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|