C15H9F3O2 — CID 138480747
[2,3-difluoro-4-(2-fluorophenyl)phenyl] prop-2-enoate (PubChem CID 138480747) has the molecular formula C15H9F3O2 and a molecular weight of 278.23 g/mol. Its IUPAC name is [2,3-difluoro-4-(2-fluorophenyl)phenyl] prop-2-enoate.
| Compound Name | [2,3-difluoro-4-(2-fluorophenyl)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 138480747 |
| Molecular Formula | C15H9F3O2 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | [2,3-difluoro-4-(2-fluorophenyl)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(-c2ccccc2F)c(F)c1F |
| InChI | InChI=1S/C15H9F3O2/c1-2-13(19)20-12-8-7-10(14(17)15(12)18)9-5-3-4-6-11(9)16/h2-8H,1H2 |
| InChIKey | HCJCISIDHCUZLN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|