C18H14F2O4 — CID 122433548
[4-(2,3-difluoro-4-prop-2-enoyloxyphenyl)cyclohexa-1,3-dien-1-yl] prop-2-enoate (PubChem CID 122433548) has the molecular formula C18H14F2O4 and a molecular weight of 332.30 g/mol. Its IUPAC name is [4-(2,3-difluoro-4-prop-2-enoyloxyphenyl)cyclohexa-1,3-dien-1-yl] prop-2-enoate.
| Compound Name | [4-(2,3-difluoro-4-prop-2-enoyloxyphenyl)cyclohexa-1,3-dien-1-yl] prop-2-enoate |
|---|---|
| PubChem CID | 122433548 |
| Molecular Formula | C18H14F2O4 |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | [4-(2,3-difluoro-4-prop-2-enoyloxyphenyl)cyclohexa-1,3-dien-1-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC1=CC=C(c2ccc(OC(=O)C=C)c(F)c2F)CC1 |
| InChI | InChI=1S/C18H14F2O4/c1-3-15(21)23-12-7-5-11(6-8-12)13-9-10-14(18(20)17(13)19)24-16(22)4-2/h3-5,7,9-10H,1-2,6,8H2 |
| InChIKey | ZLCWNBXVSVBEKG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|