C21H22O5 — CID 153034737
[4-[2-methoxy-4-(2-methylprop-2-enoyloxy)phenyl]cyclohexa-1,3-dien-1-yl] 2-methylprop-2-enoate (PubChem CID 153034737) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is [4-[2-methoxy-4-(2-methylprop-2-enoyloxy)phenyl]cyclohexa-1,3-dien-1-yl] 2-methylprop-2-enoate.
| Compound Name | [4-[2-methoxy-4-(2-methylprop-2-enoyloxy)phenyl]cyclohexa-1,3-dien-1-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153034737 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | [4-[2-methoxy-4-(2-methylprop-2-enoyloxy)phenyl]cyclohexa-1,3-dien-1-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1=CC=C(c2ccc(OC(=O)C(=C)C)cc2OC)CC1 |
| InChI | InChI=1S/C21H22O5/c1-13(2)20(22)25-16-8-6-15(7-9-16)18-11-10-17(12-19(18)24-5)26-21(23)14(3)4/h6,8,10-12H,1,3,7,9H2,2,4-5H3 |
| InChIKey | VEMWSPPJQFUWML-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|