C28H32O8 — CID 146775535
2-[4-[4-(2-methylprop-2-enoyloxy)cyclohexa-1,3-dien-1-yl]-2-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 146775535) has the molecular formula C28H32O8 and a molecular weight of 496.56 g/mol. Its IUPAC name is 2-[4-[4-(2-methylprop-2-enoyloxy)cyclohexa-1,3-dien-1-yl]-2-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[4-(2-methylprop-2-enoyloxy)cyclohexa-1,3-dien-1-yl]-2-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146775535 |
| Molecular Formula | C28H32O8 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 2-[4-[4-(2-methylprop-2-enoyloxy)cyclohexa-1,3-dien-1-yl]-2-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(C2=CC=C(OC(=O)C(=C)C)CC2)cc1OCCOC(=O)C(=C)C |
| InChI | InChI=1S/C28H32O8/c1-18(2)26(29)34-15-13-32-24-12-9-22(17-25(24)33-14-16-35-27(30)19(3)4)21-7-10-23(11-8-21)36-28(31)20(5)6/h7,9-10,12,17H,1,3,5,8,11,13-16H2,2,4,6H3 |
| InChIKey | RSQMXDYEQWLIEF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|