C29H33FO8 — CID 122549581
2-[4-[3-fluoro-5-methyl-4-(2-methylprop-2-enoyloxy)cyclohexa-1,3-dien-1-yl]-2-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 122549581) has the molecular formula C29H33FO8 and a molecular weight of 528.57 g/mol. Its IUPAC name is 2-[4-[3-fluoro-5-methyl-4-(2-methylprop-2-enoyloxy)cyclohexa-1,3-dien-1-yl]-2-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[3-fluoro-5-methyl-4-(2-methylprop-2-enoyloxy)cyclohexa-1,3-dien-1-yl]-2-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122549581 |
| Molecular Formula | C29H33FO8 |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | 2-[4-[3-fluoro-5-methyl-4-(2-methylprop-2-enoyloxy)cyclohexa-1,3-dien-1-yl]-2-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(C2=CC(F)=C(OC(=O)C(=C)C)C(C)C2)cc1OCCOC(=O)C(=C)C |
| InChI | InChI=1S/C29H33FO8/c1-17(2)27(31)36-12-10-34-24-9-8-21(16-25(24)35-11-13-37-28(32)18(3)4)22-14-20(7)26(23(30)15-22)38-29(33)19(5)6/h8-9,15-16,20H,1,3,5,10-14H2,2,4,6-7H3 |
| InChIKey | IKZCKGKGOFGNPL-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|