C35H37NO8 — CID 163857944
2-[4-[3-[3-amino-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]-5-(2-methylprop-2-enoyloxy)phenyl]-2-methylphenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 163857944) has the molecular formula C35H37NO8 and a molecular weight of 599.68 g/mol. Its IUPAC name is 2-[4-[3-[3-amino-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]-5-(2-methylprop-2-enoyloxy)phenyl]-2-methylphenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[3-[3-amino-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]-5-(2-methylprop-2-enoyloxy)phenyl]-2-methylphenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163857944 |
| Molecular Formula | C35H37NO8 |
| Molecular Weight | 599.68 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | 2-[4-[3-[3-amino-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]-5-(2-methylprop-2-enoyloxy)phenyl]-2-methylphenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(-c2cc(OC(=O)C(=C)C)cc(-c3ccc(OCCOC(=O)C(=C)C)c(N)c3)c2)cc1C |
| InChI | InChI=1S/C35H37NO8/c1-21(2)33(37)42-14-12-40-31-10-8-25(16-24(31)7)27-17-28(19-29(18-27)44-35(39)23(5)6)26-9-11-32(30(36)20-26)41-13-15-43-34(38)22(3)4/h8-11,16-20H,1,3,5,12-15,36H2,2,4,6-7H3 |
| InChIKey | OZZAMUNZSWUQNA-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.68 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|