C40H46O8 — CID 118369282
3-[2-ethyl-4-[3-[3-ethyl-4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]-5-(2-methylprop-2-enoyloxy)phenyl]phenoxy]propyl 2-methylprop-2-enoate (PubChem CID 118369282) has the molecular formula C40H46O8 and a molecular weight of 654.80 g/mol. Its IUPAC name is 3-[2-ethyl-4-[3-[3-ethyl-4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]-5-(2-methylprop-2-enoyloxy)phenyl]phenoxy]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[2-ethyl-4-[3-[3-ethyl-4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]-5-(2-methylprop-2-enoyloxy)phenyl]phenoxy]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118369282 |
| Molecular Formula | C40H46O8 |
| Molecular Weight | 654.80 g/mol |
| Exact Mass | 654.32 |
| IUPAC Name | 3-[2-ethyl-4-[3-[3-ethyl-4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]-5-(2-methylprop-2-enoyloxy)phenyl]phenoxy]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCOc1ccc(-c2cc(OC(=O)C(=C)C)cc(-c3ccc(OCCCOC(=O)C(=C)C)c(CC)c3)c2)cc1CC |
| InChI | InChI=1S/C40H46O8/c1-9-29-21-31(13-15-36(29)44-17-11-19-46-38(41)26(3)4)33-23-34(25-35(24-33)48-40(43)28(7)8)32-14-16-37(30(10-2)22-32)45-18-12-20-47-39(42)27(5)6/h13-16,21-25H,3,5,7,9-12,17-20H2,1-2,4,6,8H3 |
| InChIKey | RJAPPDVZERTVDD-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.80 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|