C34H36O7 — CID 121336175
[4-butoxy-2,5-bis[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 2-methylpropanoate (PubChem CID 121336175) has the molecular formula C34H36O7 and a molecular weight of 556.66 g/mol. Its IUPAC name is [4-butoxy-2,5-bis[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 2-methylpropanoate.
| Compound Name | [4-butoxy-2,5-bis[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 121336175 |
| Molecular Formula | C34H36O7 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | [4-butoxy-2,5-bis[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 2-methylpropanoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2cc(OC(=O)C(C)C)c(-c3ccc(OC(=O)C(=C)C)cc3)cc2OCCCC)cc1 |
| InChI | InChI=1S/C34H36O7/c1-8-9-18-38-30-19-29(25-12-16-27(17-13-25)40-33(36)22(4)5)31(41-34(37)23(6)7)20-28(30)24-10-14-26(15-11-24)39-32(35)21(2)3/h10-17,19-20,23H,2,4,8-9,18H2,1,3,5-7H3 |
| InChIKey | SJCISVJNHGEKIY-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|