C48H41NO6 — CID 148930782
[4-[4-[4-[4-(2-methylprop-2-enoyloxy)phenyl]-N-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]anilino]phenyl]phenyl] 2-methylpropanoate (PubChem CID 148930782) has the molecular formula C48H41NO6 and a molecular weight of 727.86 g/mol. Its IUPAC name is [4-[4-[4-[4-(2-methylprop-2-enoyloxy)phenyl]-N-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]anilino]phenyl]phenyl] 2-methylpropanoate.
| Compound Name | [4-[4-[4-[4-(2-methylprop-2-enoyloxy)phenyl]-N-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]anilino]phenyl]phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 148930782 |
| Molecular Formula | C48H41NO6 |
| Molecular Weight | 727.86 g/mol |
| Exact Mass | 727.29 |
| IUPAC Name | [4-[4-[4-[4-(2-methylprop-2-enoyloxy)phenyl]-N-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]anilino]phenyl]phenyl] 2-methylpropanoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(N(c3ccc(-c4ccc(OC(=O)C(=C)C)cc4)cc3)c3ccc(-c4ccc(OC(=O)C(C)C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C48H41NO6/c1-31(2)46(50)53-43-25-13-37(14-26-43)34-7-19-40(20-8-34)49(41-21-9-35(10-22-41)38-15-27-44(28-16-38)54-47(51)32(3)4)42-23-11-36(12-24-42)39-17-29-45(30-18-39)55-48(52)33(5)6/h7-30,33H,1,3H2,2,4-6H3 |
| InChIKey | PLXDFXUATIXXGS-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.86 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|