C42H35NO4 — CID 88990249
[4-[N-(8,10-dihydropyren-1-yl)-4-[4-(2-methylprop-2-enoyloxy)phenyl]anilino]phenyl] 2-methylpropanoate (PubChem CID 88990249) has the molecular formula C42H35NO4 and a molecular weight of 617.75 g/mol. Its IUPAC name is [4-[N-(8,10-dihydropyren-1-yl)-4-[4-(2-methylprop-2-enoyloxy)phenyl]anilino]phenyl] 2-methylpropanoate.
| Compound Name | [4-[N-(8,10-dihydropyren-1-yl)-4-[4-(2-methylprop-2-enoyloxy)phenyl]anilino]phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 88990249 |
| Molecular Formula | C42H35NO4 |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 617.26 |
| IUPAC Name | [4-[N-(8,10-dihydropyren-1-yl)-4-[4-(2-methylprop-2-enoyloxy)phenyl]anilino]phenyl] 2-methylpropanoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(N(c3ccc(OC(=O)C(C)C)cc3)c3ccc4ccc5c6c4c3CC=C6CC=C5)cc2)cc1 |
| InChI | InChI=1S/C42H35NO4/c1-26(2)41(44)46-35-20-12-29(13-21-35)28-10-16-33(17-11-28)43(34-18-22-36(23-19-34)47-42(45)27(3)4)38-25-15-32-9-8-30-6-5-7-31-14-24-37(38)40(32)39(30)31/h5-6,8-23,25,27H,1,7,24H2,2-4H3 |
| InChIKey | DDOJJRSVSAXBJP-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|