C64H48N2O4 — CID 58520173
[6-[N-[6-(2-methylprop-2-enoyloxy)naphthalen-2-yl]-4-[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]anilino]naphthalen-2-yl] 2-methylprop-2-enoate (PubChem CID 58520173) has the molecular formula C64H48N2O4 and a molecular weight of 909.10 g/mol. Its IUPAC name is [6-[N-[6-(2-methylprop-2-enoyloxy)naphthalen-2-yl]-4-[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]anilino]naphthalen-2-yl] 2-methylprop-2-enoate.
| Compound Name | [6-[N-[6-(2-methylprop-2-enoyloxy)naphthalen-2-yl]-4-[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]anilino]naphthalen-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58520173 |
| Molecular Formula | C64H48N2O4 |
| Molecular Weight | 909.10 g/mol |
| Exact Mass | 908.36 |
| IUPAC Name | [6-[N-[6-(2-methylprop-2-enoyloxy)naphthalen-2-yl]-4-[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]anilino]naphthalen-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc2cc(N(c3ccc(-c4ccc(N(c5ccc(-c6ccccc6)cc5)c5ccc(-c6ccccc6)cc5)cc4)cc3)c3ccc4cc(OC(=O)C(=C)C)ccc4c3)ccc2c1 |
| InChI | InChI=1S/C64H48N2O4/c1-43(2)63(67)69-61-37-25-51-39-59(35-23-53(51)41-61)66(60-36-24-54-42-62(38-26-52(54)40-60)70-64(68)44(3)4)58-33-21-50(22-34-58)49-19-31-57(32-20-49)65(55-27-15-47(16-28-55)45-11-7-5-8-12-45)56-29-17-48(18-30-56)46-13-9-6-10-14-46/h5-42H,1,3H2,2,4H3 |
| InChIKey | KWEGNUSNSAHWJG-UHFFFAOYSA-N |
| XLogP | 16.90 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.10 |
| LogP ≤ 5 | 16.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|