C29H24ClNO2 — CID 59366095
[3-[4-(N-(4-chlorophenyl)-4-methylanilino)phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 59366095) has the molecular formula C29H24ClNO2 and a molecular weight of 453.97 g/mol. Its IUPAC name is [3-[4-(N-(4-chlorophenyl)-4-methylanilino)phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [3-[4-(N-(4-chlorophenyl)-4-methylanilino)phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59366095 |
| Molecular Formula | C29H24ClNO2 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | [3-[4-(N-(4-chlorophenyl)-4-methylanilino)phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1cccc(-c2ccc(N(c3ccc(C)cc3)c3ccc(Cl)cc3)cc2)c1 |
| InChI | InChI=1S/C29H24ClNO2/c1-20(2)29(32)33-28-6-4-5-23(19-28)22-9-15-26(16-10-22)31(25-13-7-21(3)8-14-25)27-17-11-24(30)12-18-27/h4-19H,1H2,2-3H3 |
| InChIKey | QWPKMDJHVCXBGQ-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|