C28H23NO3 — CID 58800606
[4-[4-(N-phenylanilino)phenoxy]phenyl] 2-methylprop-2-enoate (PubChem CID 58800606) has the molecular formula C28H23NO3 and a molecular weight of 421.50 g/mol. Its IUPAC name is [4-[4-(N-phenylanilino)phenoxy]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-(N-phenylanilino)phenoxy]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58800606 |
| Molecular Formula | C28H23NO3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | [4-[4-(N-phenylanilino)phenoxy]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(Oc2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H23NO3/c1-21(2)28(30)32-27-19-17-26(18-20-27)31-25-15-13-24(14-16-25)29(22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-20H,1H2,2H3 |
| InChIKey | MACGDMMUBLZBCG-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|