C37H31NO4 — CID 89228398
[4-[N-(10,10c-dihydropyren-1-yl)-4-(2-methylprop-2-enoyloxy)anilino]phenyl]methyl 2-methylprop-2-enoate (PubChem CID 89228398) has the molecular formula C37H31NO4 and a molecular weight of 553.66 g/mol. Its IUPAC name is [4-[N-(10,10c-dihydropyren-1-yl)-4-(2-methylprop-2-enoyloxy)anilino]phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [4-[N-(10,10c-dihydropyren-1-yl)-4-(2-methylprop-2-enoyloxy)anilino]phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89228398 |
| Molecular Formula | C37H31NO4 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | [4-[N-(10,10c-dihydropyren-1-yl)-4-(2-methylprop-2-enoyloxy)anilino]phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1ccc(N(c2ccc(OC(=O)C(=C)C)cc2)c2ccc3c4c2CC=C2C=CC=C(C=C3)C24)cc1 |
| InChI | InChI=1S/C37H31NO4/c1-23(2)36(39)41-22-25-8-14-29(15-9-25)38(30-16-18-31(19-17-30)42-37(40)24(3)4)33-21-13-28-11-10-26-6-5-7-27-12-20-32(33)35(28)34(26)27/h5-19,21,34H,1,3,20,22H2,2,4H3 |
| InChIKey | UWMKLXHQWKZEPX-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|