C34H34O7 — CID 144772136
[4-[4-(4-methoxyphenyl)-2,5-bis(2-methylprop-2-enoyloxy)phenyl]-3-propan-2-ylphenyl] 2-methylprop-2-enoate (PubChem CID 144772136) has the molecular formula C34H34O7 and a molecular weight of 554.64 g/mol. Its IUPAC name is [4-[4-(4-methoxyphenyl)-2,5-bis(2-methylprop-2-enoyloxy)phenyl]-3-propan-2-ylphenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-(4-methoxyphenyl)-2,5-bis(2-methylprop-2-enoyloxy)phenyl]-3-propan-2-ylphenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 144772136 |
| Molecular Formula | C34H34O7 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | [4-[4-(4-methoxyphenyl)-2,5-bis(2-methylprop-2-enoyloxy)phenyl]-3-propan-2-ylphenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2cc(OC(=O)C(=C)C)c(-c3ccc(OC)cc3)cc2OC(=O)C(=C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C34H34O7/c1-19(2)27-16-25(39-32(35)20(3)4)14-15-26(27)29-18-30(40-33(36)21(5)6)28(17-31(29)41-34(37)22(7)8)23-10-12-24(38-9)13-11-23/h10-19H,3,5,7H2,1-2,4,6,8-9H3 |
| InChIKey | RCXXNDKGZRQVBL-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|