C25H24O4 — CID 137445339
[6-[4-methoxy-2-(2-methylprop-2-enoxy)phenyl]naphthalen-2-yl] 2-methylprop-2-enoate (PubChem CID 137445339) has the molecular formula C25H24O4 and a molecular weight of 388.46 g/mol. Its IUPAC name is [6-[4-methoxy-2-(2-methylprop-2-enoxy)phenyl]naphthalen-2-yl] 2-methylprop-2-enoate.
| Compound Name | [6-[4-methoxy-2-(2-methylprop-2-enoxy)phenyl]naphthalen-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 137445339 |
| Molecular Formula | C25H24O4 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | [6-[4-methoxy-2-(2-methylprop-2-enoxy)phenyl]naphthalen-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)COc1cc(OC)ccc1-c1ccc2cc(OC(=O)C(=C)C)ccc2c1 |
| InChI | InChI=1S/C25H24O4/c1-16(2)15-28-24-14-21(27-5)10-11-23(24)20-7-6-19-13-22(9-8-18(19)12-20)29-25(26)17(3)4/h6-14H,1,3,15H2,2,4-5H3 |
| InChIKey | ZNHPQEKLPJNFPC-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|