C35H30O9 — CID 122424873
[4-[6-[2-[3,4-di(prop-2-enoyloxy)phenoxy]ethoxy]naphthalen-2-yl]-3-methoxyphenyl] 2-methylprop-2-enoate (PubChem CID 122424873) has the molecular formula C35H30O9 and a molecular weight of 594.62 g/mol. Its IUPAC name is [4-[6-[2-[3,4-di(prop-2-enoyloxy)phenoxy]ethoxy]naphthalen-2-yl]-3-methoxyphenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[6-[2-[3,4-di(prop-2-enoyloxy)phenoxy]ethoxy]naphthalen-2-yl]-3-methoxyphenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122424873 |
| Molecular Formula | C35H30O9 |
| Molecular Weight | 594.62 g/mol |
| Exact Mass | 594.19 |
| IUPAC Name | [4-[6-[2-[3,4-di(prop-2-enoyloxy)phenoxy]ethoxy]naphthalen-2-yl]-3-methoxyphenyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(OCCOc2ccc3cc(-c4ccc(OC(=O)C(=C)C)cc4OC)ccc3c2)cc1OC(=O)C=C |
| InChI | InChI=1S/C35H30O9/c1-6-33(36)43-30-15-13-27(20-32(30)44-34(37)7-2)41-17-16-40-26-11-10-23-18-25(9-8-24(23)19-26)29-14-12-28(21-31(29)39-5)42-35(38)22(3)4/h6-15,18-21H,1-3,16-17H2,4-5H3 |
| InChIKey | SNYGJNUVPPTFSH-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.62 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|