C32H28O8 — CID 144761458
[3-methoxy-4-[6-[2-(4-methoxy-3-prop-2-enoyloxyphenoxy)ethoxy]naphthalen-2-yl]phenyl] prop-2-enoate (PubChem CID 144761458) has the molecular formula C32H28O8 and a molecular weight of 540.57 g/mol. Its IUPAC name is [3-methoxy-4-[6-[2-(4-methoxy-3-prop-2-enoyloxyphenoxy)ethoxy]naphthalen-2-yl]phenyl] prop-2-enoate.
| Compound Name | [3-methoxy-4-[6-[2-(4-methoxy-3-prop-2-enoyloxyphenoxy)ethoxy]naphthalen-2-yl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 144761458 |
| Molecular Formula | C32H28O8 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | [3-methoxy-4-[6-[2-(4-methoxy-3-prop-2-enoyloxyphenoxy)ethoxy]naphthalen-2-yl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(-c2ccc3cc(OCCOc4ccc(OC)c(OC(=O)C=C)c4)ccc3c2)c(OC)c1 |
| InChI | InChI=1S/C32H28O8/c1-5-31(33)39-26-11-13-27(29(20-26)36-4)23-8-7-22-18-24(10-9-21(22)17-23)37-15-16-38-25-12-14-28(35-3)30(19-25)40-32(34)6-2/h5-14,17-20H,1-2,15-16H2,3-4H3 |
| InChIKey | LOXBQSVASSISTH-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|