C30H30O6 — CID 144772034
ethane;[4-[3-methoxy-4-(4-prop-2-enoyloxyphenyl)phenyl]phenyl] prop-2-enoate;prop-2-enal (PubChem CID 144772034) has the molecular formula C30H30O6 and a molecular weight of 486.56 g/mol. Its IUPAC name is ethane;[4-[3-methoxy-4-(4-prop-2-enoyloxyphenyl)phenyl]phenyl] prop-2-enoate;prop-2-enal.
| Compound Name | ethane;[4-[3-methoxy-4-(4-prop-2-enoyloxyphenyl)phenyl]phenyl] prop-2-enoate;prop-2-enal |
|---|---|
| PubChem CID | 144772034 |
| Molecular Formula | C30H30O6 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | ethane;[4-[3-methoxy-4-(4-prop-2-enoyloxyphenyl)phenyl]phenyl] prop-2-enoate;prop-2-enal |
| SMILES | C=CC(=O)Oc1ccc(-c2ccc(-c3ccc(OC(=O)C=C)cc3)c(OC)c2)cc1.C=CC=O.CC |
| InChI | InChI=1S/C25H20O5.C3H4O.C2H6/c1-4-24(26)29-20-11-6-17(7-12-20)19-10-15-22(23(16-19)28-3)18-8-13-21(14-9-18)30-25(27)5-2;1-2-3-4;1-2/h4-16H,1-2H2,3H3;2-3H,1H2;1-2H3 |
| InChIKey | ACFRDMYRTIGROV-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|