C33H36O7 — CID 144736972
[4-[5-methoxy-4-(4-methoxyphenyl)-2-(2-methylprop-1-enoxy)phenyl]phenyl] prop-2-enoate;propanal;prop-2-enal (PubChem CID 144736972) has the molecular formula C33H36O7 and a molecular weight of 544.64 g/mol. Its IUPAC name is [4-[5-methoxy-4-(4-methoxyphenyl)-2-(2-methylprop-1-enoxy)phenyl]phenyl] prop-2-enoate;propanal;prop-2-enal.
| Compound Name | [4-[5-methoxy-4-(4-methoxyphenyl)-2-(2-methylprop-1-enoxy)phenyl]phenyl] prop-2-enoate;propanal;prop-2-enal |
|---|---|
| PubChem CID | 144736972 |
| Molecular Formula | C33H36O7 |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | [4-[5-methoxy-4-(4-methoxyphenyl)-2-(2-methylprop-1-enoxy)phenyl]phenyl] prop-2-enoate;propanal;prop-2-enal |
| SMILES | C=CC(=O)Oc1ccc(-c2cc(OC)c(-c3ccc(OC)cc3)cc2OC=C(C)C)cc1.C=CC=O.CCC=O |
| InChI | InChI=1S/C27H26O5.C3H6O.C3H4O/c1-6-27(28)32-22-13-9-20(10-14-22)24-15-25(30-5)23(16-26(24)31-17-18(2)3)19-7-11-21(29-4)12-8-19;2*1-2-3-4/h6-17H,1H2,2-5H3;3H,2H2,1H3;2-3H,1H2 |
| InChIKey | PUKWNUGDISPCIN-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|