C27H28O6 — CID 144772103
[5-(4-hydroxyphenyl)-2-(4-methoxyphenyl)-4-methylphenyl] prop-2-enoate;methanol;prop-2-enal (PubChem CID 144772103) has the molecular formula C27H28O6 and a molecular weight of 448.52 g/mol. Its IUPAC name is [5-(4-hydroxyphenyl)-2-(4-methoxyphenyl)-4-methylphenyl] prop-2-enoate;methanol;prop-2-enal.
| Compound Name | [5-(4-hydroxyphenyl)-2-(4-methoxyphenyl)-4-methylphenyl] prop-2-enoate;methanol;prop-2-enal |
|---|---|
| PubChem CID | 144772103 |
| Molecular Formula | C27H28O6 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | [5-(4-hydroxyphenyl)-2-(4-methoxyphenyl)-4-methylphenyl] prop-2-enoate;methanol;prop-2-enal |
| SMILES | C=CC(=O)Oc1cc(-c2ccc(O)cc2)c(C)cc1-c1ccc(OC)cc1.C=CC=O.CO |
| InChI | InChI=1S/C23H20O4.C3H4O.CH4O/c1-4-23(25)27-22-14-20(16-5-9-18(24)10-6-16)15(2)13-21(22)17-7-11-19(26-3)12-8-17;1-2-3-4;1-2/h4-14,24H,1H2,2-3H3;2-3H,1H2;2H,1H3 |
| InChIKey | WHYFXTOTAYVAIB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|