C29H28O5 — CID 144736942
[4-[2-[(E)-but-2-enoxy]-4-(4-methoxyphenyl)phenyl]phenyl] prop-2-enoate;prop-2-enal (PubChem CID 144736942) has the molecular formula C29H28O5 and a molecular weight of 456.54 g/mol. Its IUPAC name is [4-[2-[(E)-but-2-enoxy]-4-(4-methoxyphenyl)phenyl]phenyl] prop-2-enoate;prop-2-enal.
| Compound Name | [4-[2-[(E)-but-2-enoxy]-4-(4-methoxyphenyl)phenyl]phenyl] prop-2-enoate;prop-2-enal |
|---|---|
| PubChem CID | 144736942 |
| Molecular Formula | C29H28O5 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | [4-[2-[(E)-but-2-enoxy]-4-(4-methoxyphenyl)phenyl]phenyl] prop-2-enoate;prop-2-enal |
| SMILES | C=CC(=O)Oc1ccc(-c2ccc(-c3ccc(OC)cc3)cc2OC/C=C/C)cc1.C=CC=O |
| InChI | InChI=1S/C26H24O4.C3H4O/c1-4-6-17-29-25-18-21(19-7-12-22(28-3)13-8-19)11-16-24(25)20-9-14-23(15-10-20)30-26(27)5-2;1-2-3-4/h4-16,18H,2,17H2,1,3H3;2-3H,1H2/b6-4+; |
| InChIKey | JUCLYTMPUGYZDX-CVDVRWGVSA-N |
| XLogP | 6.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|