C31H28O8 — CID 155139427
[4-[4-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]-3-prop-2-enoyloxyphenyl]phenyl] 2-(methoxymethyl)prop-2-enoate (PubChem CID 155139427) has the molecular formula C31H28O8 and a molecular weight of 528.56 g/mol. Its IUPAC name is [4-[4-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]-3-prop-2-enoyloxyphenyl]phenyl] 2-(methoxymethyl)prop-2-enoate.
| Compound Name | [4-[4-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]-3-prop-2-enoyloxyphenyl]phenyl] 2-(methoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 155139427 |
| Molecular Formula | C31H28O8 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | [4-[4-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]-3-prop-2-enoyloxyphenyl]phenyl] 2-(methoxymethyl)prop-2-enoate |
| SMILES | C=CC(=O)Oc1cc(-c2ccc(OC(=O)C(=C)COC)cc2)ccc1-c1ccc(OC(=O)C(=C)COC)cc1 |
| InChI | InChI=1S/C31H28O8/c1-6-29(32)39-28-17-24(22-7-12-25(13-8-22)37-30(33)20(2)18-35-4)11-16-27(28)23-9-14-26(15-10-23)38-31(34)21(3)19-36-5/h6-17H,1-3,18-19H2,4-5H3 |
| InChIKey | LBFKICSCOALNMF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|