C33H42O5 — CID 146669112
[4-[3-[2-(4-pentylcyclohexyl)ethyl]-4-prop-2-enoyloxyphenyl]phenyl] 2-(methoxymethyl)prop-2-enoate (PubChem CID 146669112) has the molecular formula C33H42O5 and a molecular weight of 518.69 g/mol. Its IUPAC name is [4-[3-[2-(4-pentylcyclohexyl)ethyl]-4-prop-2-enoyloxyphenyl]phenyl] 2-(methoxymethyl)prop-2-enoate.
| Compound Name | [4-[3-[2-(4-pentylcyclohexyl)ethyl]-4-prop-2-enoyloxyphenyl]phenyl] 2-(methoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 146669112 |
| Molecular Formula | C33H42O5 |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | [4-[3-[2-(4-pentylcyclohexyl)ethyl]-4-prop-2-enoyloxyphenyl]phenyl] 2-(methoxymethyl)prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(-c2ccc(OC(=O)C(=C)COC)cc2)cc1CCC1CCC(CCCCC)CC1 |
| InChI | InChI=1S/C33H42O5/c1-5-7-8-9-25-10-12-26(13-11-25)14-15-29-22-28(18-21-31(29)38-32(34)6-2)27-16-19-30(20-17-27)37-33(35)24(3)23-36-4/h6,16-22,25-26H,2-3,5,7-15,23H2,1,4H3 |
| InChIKey | LSHHUFUNSNBERG-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|