C36H40O5 — CID 146668096
[4-[4-(2-methylprop-2-enoyloxy)-3-[4-(4-propylcyclohexyl)phenyl]phenyl]phenyl] 2-(methoxymethyl)prop-2-enoate (PubChem CID 146668096) has the molecular formula C36H40O5 and a molecular weight of 552.71 g/mol. Its IUPAC name is [4-[4-(2-methylprop-2-enoyloxy)-3-[4-(4-propylcyclohexyl)phenyl]phenyl]phenyl] 2-(methoxymethyl)prop-2-enoate.
| Compound Name | [4-[4-(2-methylprop-2-enoyloxy)-3-[4-(4-propylcyclohexyl)phenyl]phenyl]phenyl] 2-(methoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 146668096 |
| Molecular Formula | C36H40O5 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | [4-[4-(2-methylprop-2-enoyloxy)-3-[4-(4-propylcyclohexyl)phenyl]phenyl]phenyl] 2-(methoxymethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(OC(=O)C(=C)COC)cc2)cc1-c1ccc(C2CCC(CCC)CC2)cc1 |
| InChI | InChI=1S/C36H40O5/c1-6-7-26-8-10-27(11-9-26)28-12-14-30(15-13-28)33-22-31(18-21-34(33)41-35(37)24(2)3)29-16-19-32(20-17-29)40-36(38)25(4)23-39-5/h12-22,26-27H,2,4,6-11,23H2,1,3,5H3 |
| InChIKey | XXMPWIRWTUMWRZ-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|