C32H38O5 — CID 146668717
[4-[4-(2-methylprop-2-enoyloxy)phenyl]-2-(4-pentylcyclohex-3-en-1-yl)phenyl] 2-(methoxymethyl)prop-2-enoate (PubChem CID 146668717) has the molecular formula C32H38O5 and a molecular weight of 502.65 g/mol. Its IUPAC name is [4-[4-(2-methylprop-2-enoyloxy)phenyl]-2-(4-pentylcyclohex-3-en-1-yl)phenyl] 2-(methoxymethyl)prop-2-enoate.
| Compound Name | [4-[4-(2-methylprop-2-enoyloxy)phenyl]-2-(4-pentylcyclohex-3-en-1-yl)phenyl] 2-(methoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 146668717 |
| Molecular Formula | C32H38O5 |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | [4-[4-(2-methylprop-2-enoyloxy)phenyl]-2-(4-pentylcyclohex-3-en-1-yl)phenyl] 2-(methoxymethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(OC(=O)C(=C)COC)c(C3CC=C(CCCCC)CC3)c2)cc1 |
| InChI | InChI=1S/C32H38O5/c1-6-7-8-9-24-10-12-26(13-11-24)29-20-27(16-19-30(29)37-32(34)23(4)21-35-5)25-14-17-28(18-15-25)36-31(33)22(2)3/h10,14-20,26H,2,4,6-9,11-13,21H2,1,3,5H3 |
| InChIKey | YFNBTEVWEVOYSF-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|