C33H34O7 — CID 146668748
(4-pentylphenyl) 5-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]-2-(2-methylprop-2-enoyloxy)benzoate (PubChem CID 146668748) has the molecular formula C33H34O7 and a molecular weight of 542.63 g/mol. Its IUPAC name is (4-pentylphenyl) 5-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]-2-(2-methylprop-2-enoyloxy)benzoate.
| Compound Name | (4-pentylphenyl) 5-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]-2-(2-methylprop-2-enoyloxy)benzoate |
|---|---|
| PubChem CID | 146668748 |
| Molecular Formula | C33H34O7 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | (4-pentylphenyl) 5-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]-2-(2-methylprop-2-enoyloxy)benzoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(OC(=O)C(=C)COC)cc2)cc1C(=O)Oc1ccc(CCCCC)cc1 |
| InChI | InChI=1S/C33H34O7/c1-6-7-8-9-24-10-15-27(16-11-24)39-33(36)29-20-26(14-19-30(29)40-31(34)22(2)3)25-12-17-28(18-13-25)38-32(35)23(4)21-37-5/h10-20H,2,4,6-9,21H2,1,3,5H3 |
| InChIKey | YWYRYVANAPPELM-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|