C39H36O7 — CID 146667989
[4-[3-[(E)-3-[4-(4-butylphenyl)phenyl]prop-2-enoyl]oxy-4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 146667989) has the molecular formula C39H36O7 and a molecular weight of 616.71 g/mol. Its IUPAC name is [4-[3-[(E)-3-[4-(4-butylphenyl)phenyl]prop-2-enoyl]oxy-4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [4-[3-[(E)-3-[4-(4-butylphenyl)phenyl]prop-2-enoyl]oxy-4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 146667989 |
| Molecular Formula | C39H36O7 |
| Molecular Weight | 616.71 g/mol |
| Exact Mass | 616.25 |
| IUPAC Name | [4-[3-[(E)-3-[4-(4-butylphenyl)phenyl]prop-2-enoyl]oxy-4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(OC(=O)C(=C)CO)cc2)cc1OC(=O)/C=C/c1ccc(-c2ccc(CCCC)cc2)cc1 |
| InChI | InChI=1S/C39H36O7/c1-5-6-7-28-8-13-30(14-9-28)31-15-10-29(11-16-31)12-23-37(41)45-36-24-33(19-22-35(36)46-38(42)26(2)3)32-17-20-34(21-18-32)44-39(43)27(4)25-40/h8-24,40H,2,4-7,25H2,1,3H3/b23-12+ |
| InChIKey | LGNIWVQVEIKGOK-FSJBWODESA-N |
| XLogP | 7.92 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.71 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|