C31H26O8 — CID 118680428
[2-prop-2-enoyloxy-4-[4-[3-(4-prop-2-enoyloxyphenyl)propanoyloxy]phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 118680428) has the molecular formula C31H26O8 and a molecular weight of 526.54 g/mol. Its IUPAC name is [2-prop-2-enoyloxy-4-[4-[3-(4-prop-2-enoyloxyphenyl)propanoyloxy]phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [2-prop-2-enoyloxy-4-[4-[3-(4-prop-2-enoyloxyphenyl)propanoyloxy]phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118680428 |
| Molecular Formula | C31H26O8 |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | [2-prop-2-enoyloxy-4-[4-[3-(4-prop-2-enoyloxyphenyl)propanoyloxy]phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(CCC(=O)Oc2ccc(-c3ccc(OC(=O)C(=C)C)c(OC(=O)C=C)c3)cc2)cc1 |
| InChI | InChI=1S/C31H26O8/c1-5-28(32)36-24-13-7-21(8-14-24)9-18-30(34)37-25-15-10-22(11-16-25)23-12-17-26(39-31(35)20(3)4)27(19-23)38-29(33)6-2/h5-8,10-17,19H,1-3,9,18H2,4H3 |
| InChIKey | JIYWPFYOFIJINR-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|