C31H28O8 — CID 146245833
[4-[4-[3-[3,4-di(prop-2-enoyloxy)phenyl]propanoyloxy]phenyl]phenyl] 2-methylpropanoate (PubChem CID 146245833) has the molecular formula C31H28O8 and a molecular weight of 528.56 g/mol. Its IUPAC name is [4-[4-[3-[3,4-di(prop-2-enoyloxy)phenyl]propanoyloxy]phenyl]phenyl] 2-methylpropanoate.
| Compound Name | [4-[4-[3-[3,4-di(prop-2-enoyloxy)phenyl]propanoyloxy]phenyl]phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 146245833 |
| Molecular Formula | C31H28O8 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | [4-[4-[3-[3,4-di(prop-2-enoyloxy)phenyl]propanoyloxy]phenyl]phenyl] 2-methylpropanoate |
| SMILES | C=CC(=O)Oc1ccc(CCC(=O)Oc2ccc(-c3ccc(OC(=O)C(C)C)cc3)cc2)cc1OC(=O)C=C |
| InChI | InChI=1S/C31H28O8/c1-5-28(32)38-26-17-7-21(19-27(26)39-29(33)6-2)8-18-30(34)36-24-13-9-22(10-14-24)23-11-15-25(16-12-23)37-31(35)20(3)4/h5-7,9-17,19-20H,1-2,8,18H2,3-4H3 |
| InChIKey | YUTVVLCPYBYJQH-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|